CAS 1198-79-4

Pyrazolo[1,5-a]pyrimidin-2-amine, 5,7-dimethyl-, hydrochloride (1:1)

Description:

Pyrazolo[1,5-a]pyrimidin-2-amine, 5,7-dimethyl-, hydrochloride (1:1), with CAS number 1198-79-4, is a chemical compound characterized by its pyrazolo and pyrimidine ring structures. This compound features a pyrazolo moiety fused to a pyrimidine ring, which contributes to its unique chemical properties and potential biological activities. The presence of two methyl groups at the 5 and 7 positions enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential for use in the development of therapeutic agents, particularly in areas such as oncology or neurology. However, specific biological activities and mechanisms of action would require further investigation through experimental studies.

Formula: C₈H₁₀N₄.ClH

InChI: InChI=1S/C8H10N4.ClH/c1-5-3-6(2)12-8(10-5)4-7(9)11-12;/h3-4H,1-2H3,(H2,9,11);1H

InChI key: InChIKey=ZORRDWLKRAQYPB-UHFFFAOYSA-N

SMILES: CC=1N2C(=CC(N)=N2)N=C(C)C1.Cl

5,7-dimethylpyrazolo[1,5-a]pyrimidin-2-amine

CAS: 1198-79-4

Formula: C₈H₁₁ClN₄

Molecular weight: 198.65

Ref: 10-F428647

5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-amine hydrochloride

CAS: 1198-79-4

Versatile small molecule scaffold

Formula: C₈H₁₁ClN₄

Purity: Min. 95%

Molecular weight: 198.65 g/mol

Ref: 3D-BAA19879