CAS 1198-98-7
:5-Methyl-3-phenyl-1,2,4-oxadiazole
Description:
5-Methyl-3-phenyl-1,2,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered heterocyclic structure. This compound features a methyl group at the 5-position and a phenyl group at the 3-position of the oxadiazole ring, contributing to its unique chemical properties. It is typically a crystalline solid and may exhibit moderate solubility in organic solvents. The presence of the oxadiazole moiety often imparts interesting electronic properties, making it a subject of interest in materials science and medicinal chemistry. This compound may exhibit biological activity, including potential antimicrobial or anti-inflammatory effects, although specific biological data can vary. Its stability and reactivity can be influenced by the substituents on the ring, and it may participate in various chemical reactions typical of heterocycles, such as nucleophilic substitutions or cycloadditions. Overall, 5-Methyl-3-phenyl-1,2,4-oxadiazole is a versatile compound with potential applications in various fields.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-7-10-9(11-12-7)8-5-3-2-4-6-8/h2-6H,1H3
SMILES:Cc1nc(c2ccccc2)no1
Synonyms:- Phenylmethyloxadiazole
- Nsc 167113
- 1,2,4-Oxadiazole, 5-methyl-3-phenyl- (8CI)(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Methyl-3-phenyl-1,2,4-oxadiazole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H8N2OPurity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:160.171,2,4-Oxadiazole, 5-methyl-3-phenyl-
CAS:Formula:C9H8N2OPurity:97%Color and Shape:LiquidMolecular weight:160.17265-Methyl-3-phenyl-1,2,4-oxadiazole
CAS:5-Methyl-3-phenyl-1,2,4-oxadiazolePurity:≥95%Color and Shape:SolidMolecular weight:160.17g/mol



