
CAS 119804-96-5: 2′-Deoxy-2′-methylenecytidine
Description:2′-Deoxy-2′-methylenecytidine is a modified nucleoside analog of cytidine, characterized by the presence of a methylene group at the 2′ position of the sugar moiety. This modification imparts unique properties to the molecule, influencing its biological activity and stability. The compound is typically a white to off-white solid and is soluble in polar solvents, which facilitates its use in various biochemical applications. As a nucleoside analog, it can interfere with nucleic acid synthesis and has potential implications in antiviral and anticancer therapies. The presence of the methylene group enhances its resistance to nucleases, making it a valuable tool in molecular biology and medicinal chemistry. Additionally, its structural features allow for potential incorporation into RNA or DNA, which can be exploited in research and therapeutic contexts. Overall, 2′-Deoxy-2′-methylenecytidine represents a significant compound in the study of nucleoside analogs and their applications in drug development.
Formula:C10H13N3O4
InChI:InChI=1S/C10H13N3O4/c1-5-8(15)6(4-14)17-9(5)13-3-2-7(11)12-10(13)16/h2-3,6,8-9,14-15H,1,4H2,(H2,11,12,16)/t6-,8+,9-/m1/s1
InChI key:InChIKey=PULHLIOPJXPGJN-BWVDBABLSA-N
SMILES:O=C1N=C(N)C=CN1C2OC(CO)C(O)C2=C
- Synonyms:
- 2′-Deoxy-2′-methylenecytidine
- Cytidine, 2′-deoxy-2′-methylene-
- DMDC
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Sofosbuvir Impurity 123 REF: 4Z-S-055133CAS: 119804-96-5 | - - - | To inquire | Wed 05 Mar 25 |

Ref: 4Z-S-055133
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |