CymitQuimica logo

CAS 1198096-23-9

:

5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine

Description:
5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex structure, which includes a pyrrolo[2,3-b]pyridine core and a boron-containing dioxaborolane moiety. This compound features a methyl group at the 5-position of the pyrrole ring and a dioxaborolane group that enhances its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions. The presence of the boron atom can facilitate the formation of organoboron intermediates, making it useful in various synthetic pathways, including those involving carbon-carbon bond formation. Additionally, the compound's unique structural features may impart specific electronic properties, influencing its behavior in chemical reactions. Its solubility, stability, and reactivity can vary based on the solvent and conditions used, making it a subject of interest in both academic and industrial research settings. Overall, this compound exemplifies the intersection of heterocyclic chemistry and organoboron chemistry, with potential applications in pharmaceuticals and materials science.
Formula:C14H19BN2O2
InChI:InChI=1S/C14H19BN2O2/c1-9-6-10-11(8-17-12(10)16-7-9)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3,(H,16,17)
InChI key:InChIKey=VVQUQQDNKMKSCI-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CNC2=NC1)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine
  • 5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrrolo[2,4-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.