CAS 1198096-55-7
:1,1-Dimethylethyl 5-bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine-1-carboxylate
Description:
1,1-Dimethylethyl 5-bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of bromine and chlorine substituents indicates that it may exhibit unique electronic properties and reactivity patterns, making it of interest in medicinal chemistry and material science. The tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. As a heterocyclic compound, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its specific applications would depend on its biological activity, which could be explored in drug development or as a building block in the synthesis of more complex molecules. Overall, this compound represents a valuable entity for research in both synthetic and medicinal chemistry.
Formula:C12H12BrClN2O2
InChI:InChI=1S/C12H12BrClN2O2/c1-12(2,3)18-11(17)16-5-4-7-6-8(13)15-10(14)9(7)16/h4-6H,1-3H3
InChI key:InChIKey=ZTHJWXDIQUDVFC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=C1)=CC(Br)=NC2Cl
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine-1-carboxylic acid, 5-bromo-7-chloro-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 5-bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 5-bromo-7-chloro-1h-pyrrolo-[2,3-c]pyridine-1-carboxylate
CAS:Formula:C12H12BrClN2O2Molecular weight:331.5929
