CAS 1198097-05-0

7-Chloro-5-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine

Description:

7-Chloro-5-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine is a synthetic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with chlorine and iodine atoms, as well as a tris(1-methylethyl)silyl group. This compound is notable for its potential applications in medicinal chemistry and material science due to the presence of halogen substituents, which can influence its reactivity and biological activity. The silyl group enhances its stability and solubility in organic solvents, making it suitable for various synthetic pathways. The presence of multiple functional groups suggests that it may participate in diverse chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the compound's unique structural features may contribute to its potential as a ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules. Overall, its distinctive characteristics make it a subject of interest in both research and industrial applications.

Formula: C₁₆H₂₄ClIN₂Si

InChI: InChI=1S/C16H24ClIN2Si/c1-10(2)21(11(3)4,12(5)6)20-8-7-13-9-14(18)19-16(17)15(13)20/h7-12H,1-6H3

InChI key: InChIKey=GVDQHJAMEWUACG-UHFFFAOYSA-N

SMILES: [Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=CC(I)=NC2Cl

Synonyms:

• 7-Chloro-5-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-c]pyridine
• 1H-Pyrrolo[2,3-c]pyridine, 7-chloro-5-iodo-1-[tris(1-methylethyl)silyl]-