
CAS 1198117-94-0
:4-(2,2,2-Trifluoroethyl)benzenemethanamine
Description:
4-(2,2,2-Trifluoroethyl)benzenemethanamine, identified by its CAS number 1198117-94-0, is an organic compound characterized by the presence of a benzene ring substituted with a trifluoroethyl group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the trifluoroethyl moiety, which can influence its solubility and reactivity. The amine group can participate in hydrogen bonding, affecting its interaction with other molecules. The trifluoromethyl group is known for imparting unique electronic properties, which can enhance the compound's stability and reactivity in various chemical reactions. Additionally, the presence of fluorine atoms often contributes to increased lipophilicity and can affect the compound's biological activity. Overall, this compound may find applications in pharmaceuticals, agrochemicals, or materials science, where its specific properties can be leveraged for desired outcomes.
Formula:C9H10F3N
InChI:InChI=1S/C9H10F3N/c10-9(11,12)5-7-1-3-8(6-13)4-2-7/h1-4H,5-6,13H2
InChI key:InChIKey=ZTEJORXFGZIUAC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=CC=C(CN)C=C1
Synonyms:- 4-(2,2,2-Trifluoroethyl)benzylamine
- 4-(2,2,2-Trifluoroethyl)benzenemethanamine
- 1-[4-(2,2,2-Trifluoroethyl)phenyl]methanamine
- Benzenemethanamine, 4-(2,2,2-trifluoroethyl)-
- [4-(2,2,2-Trifluoroethyl)phenyl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.