CymitQuimica logo

CAS 119817-92-4

:

Securinan-11-one, 14,15-dihydro-15-hydroxy-, (2α,15β)-

Description:
Securinan-11-one, 14,15-dihydro-15-hydroxy-, (2α,15β)-, with the CAS number 119817-92-4, is a chemical compound belonging to the class of alkaloids, specifically derived from the Securinega genus of plants. This compound exhibits a complex molecular structure characterized by multiple functional groups, including a ketone and hydroxyl groups, which contribute to its biological activity. It is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. The stereochemistry indicated by the (2α,15β) designation suggests specific spatial arrangements of atoms that can influence the compound's interaction with biological targets. Additionally, its solubility and stability can vary depending on environmental conditions, which is crucial for its application in drug formulation. Research into this compound is ongoing, focusing on its mechanisms of action and potential therapeutic uses, particularly in the context of traditional medicine and modern pharmacology.
Formula:C13H17NO3
InChI:InChI=1S/C13H17NO3/c15-10-5-8-6-12(16)17-13(8)7-9(10)14-4-2-1-3-11(13)14/h6,9-11,15H,1-5,7H2/t9-,10+,11-,13-/m0/s1
InChI key:InChIKey=OHLFUILALUNTGR-NOHGZBONSA-N
SMILES:O=C1O[C@@]23[C@]4(N([C@@](C2)([C@H](O)CC3=C1)[H])CCCC4)[H]
Synonyms:
  • 14,15-Dihydroallosecurinin-15β-ol
  • 8H-6,11b-Methanofuro[2,3-c]pyrido[1,2-a]azepine, securinan-11-one deriv.
  • Securinan-11-one, 14,15-dihydro-15-hydroxy-, (2α,15β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.