CAS 1198171-20-8

2-(Difluoromethyl)-4-fluorobenzaldehyde

Description:

2-(Difluoromethyl)-4-fluorobenzaldehyde is an organic compound characterized by its unique structure, which includes a benzaldehyde functional group and two fluorine atoms attached to a difluoromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular formula reflects the presence of carbon, hydrogen, and fluorine atoms, contributing to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its biological activity. Additionally, this compound may exhibit specific physical properties such as boiling point, melting point, and solubility in organic solvents, which are important for its handling and application in laboratory settings. Safety data sheets would provide essential information regarding its toxicity, handling precautions, and environmental impact, making it crucial for users to adhere to safety guidelines when working with this substance.

Formula: C₈H₅F₃O

InChI: InChI=1S/C8H5F3O/c9-6-2-1-5(4-12)7(3-6)8(10)11/h1-4,8H

InChI key: InChIKey=AUOQUJCFZDEZSW-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(C=O)C=CC(F)=C1

Synonyms:

• 2-(Difluoromethyl)-4-fluorobenzaldehyde
• Benzaldehyde, 2-(difluoromethyl)-4-fluoro-