CAS 119828-60-3
:4-(2-methoxyethoxymethyl)benzoic acid
Description:
4-(2-Methoxyethoxymethyl)benzoic acid, with the CAS number 119828-60-3, is an organic compound characterized by its benzoic acid structure modified with a methoxyethoxymethyl group at the para position. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid group. The presence of the methoxyethoxymethyl substituent can influence its reactivity and solubility, potentially enhancing its lipophilicity compared to simpler benzoic acids. This compound may be utilized in various applications, including pharmaceuticals, where it could serve as an intermediate or a building block in the synthesis of more complex molecules. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Overall, the characteristics of this compound are defined by its functional groups, which contribute to its chemical behavior and potential applications in various fields.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-14-6-7-15-8-9-2-4-10(5-3-9)11(12)13/h2-5H,6-8H2,1H3,(H,12,13)
SMILES:COCCOCc1ccc(cc1)C(=O)O
Synonyms:- 4-[(2-Methoxyethoxy)Methyl]Benzoic Acid
- Benzoic Acid, 4-[(2-Methoxyethoxy)Methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
