CAS 1198283-55-4

Imidazo[1,2-a]pyridine-5-carboxylic acid, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-5-carboxylic acid, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system comprising both imidazole and pyridine moieties. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The carboxylic acid functional group contributes to its acidic properties, making it relevant in various chemical reactions and applications, particularly in medicinal chemistry. Its unique structure allows for potential interactions with biological targets, making it a subject of interest in drug development. The compound's CAS number, 1198283-55-4, serves as a unique identifier in chemical databases, facilitating research and regulatory compliance. Overall, Imidazo[1,2-a]pyridine-5-carboxylic acid, hydrochloride is notable for its structural complexity and potential utility in pharmaceutical applications.

Formula: C₈H₆N₂O₂·ClH

InChI: InChI=1S/C8H6N2O2.ClH/c11-8(12)6-2-1-3-7-9-4-5-10(6)7;/h1-5H,(H,11,12);1H

InChI key: InChIKey=FOCICUCHBMFSBI-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NC=C2)C=CC1.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-5-carboxylic acid, hydrochloride (1:1)

Imidazo[1,2-a]pyridine-5-carboxylic acid, HCl

CAS: 1198283-55-4

Formula: C₈H₇ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.6064

Ref: IN-DA000PPJ

Imidazo[1,2-a]pyridine-5-carboxylic acid hydrochloride

CAS: 1198283-55-4

Formula: C₈H₇ClN₂O₂

Purity: 95.0%

Molecular weight: 198.61

Ref: 10-F225720

Imidazo[1,2-a]pyridine-5-carboxylic acid HCl

CAS: 1198283-55-4

Versatile small molecule scaffold

Formula: C₈H₆N₂O₂·HCl

Purity: Min. 95%

Molecular weight: 198.61 g/mol

Ref: 3D-YXB28355