CymitQuimica logo

CAS 1198286-37-1

:

4-(3,4-Difluorophenyl)-1-methyl-4-piperidinol

Description:
4-(3,4-Difluorophenyl)-1-methyl-4-piperidinol is a chemical compound characterized by its piperidine structure, which includes a piperidinol moiety substituted with a 3,4-difluorophenyl group. This compound typically exhibits properties associated with piperidine derivatives, such as potential solubility in polar solvents and moderate lipophilicity due to the presence of the aromatic fluorinated substituent. The difluorophenyl group may influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. Additionally, the presence of the hydroxyl group in the piperidinol structure can contribute to hydrogen bonding capabilities, affecting its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could impart specific pharmacological properties. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied or utilized.
Formula:C12H15F2NO
InChI:InChI=1S/C12H15F2NO/c1-15-6-4-12(16,5-7-15)9-2-3-10(13)11(14)8-9/h2-3,8,16H,4-7H2,1H3
InChI key:InChIKey=ZFYVIWZQAZVDCO-UHFFFAOYSA-N
SMILES:OC1(C2=CC(F)=C(F)C=C2)CCN(C)CC1
Synonyms:
  • 4-Piperidinol, 4-(3,4-difluorophenyl)-1-methyl-
  • 4-(3,4-Difluorophenyl)-1-methyl-4-piperidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.