CAS 1198286-39-3
:4-(3,5-Dichlorophenyl)-1-methyl-4-piperidinol
Description:
4-(3,5-Dichlorophenyl)-1-methyl-4-piperidinol is a chemical compound characterized by its piperidine structure, which includes a piperidinol moiety substituted with a 3,5-dichlorophenyl group. This compound typically exhibits properties associated with both piperidine derivatives and chlorinated aromatic compounds, such as moderate to high lipophilicity, which can influence its solubility in organic solvents. The presence of the dichlorophenyl group may impart biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The hydroxyl group in the piperidinol structure can participate in hydrogen bonding, affecting its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential for various synthetic modifications, which could lead to derivatives with altered pharmacological profiles. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those with halogen substituents, which may pose environmental and health risks.
Formula:C12H15Cl2NO
InChI:InChI=1S/C12H15Cl2NO/c1-15-4-2-12(16,3-5-15)9-6-10(13)8-11(14)7-9/h6-8,16H,2-5H2,1H3
InChI key:InChIKey=HWBHOCMSIPAXEL-UHFFFAOYSA-N
SMILES:OC1(C2=CC(Cl)=CC(Cl)=C2)CCN(C)CC1
Synonyms:- 4-Piperidinol, 4-(3,5-dichlorophenyl)-1-methyl-
- 4-(3,5-Dichlorophenyl)-1-methyl-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.