
CAS 1198286-88-2
:7-Azaspiro[4.5]decane, hydrochloride (1:1)
Description:
7-Azaspiro[4.5]decane, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom integrated into a bicyclic framework. This compound typically exhibits properties associated with spiro compounds, such as potential biological activity and the ability to interact with various receptors due to its structural conformation. The hydrochloride salt form indicates that it is a hydrochloride, which often enhances solubility in water and may influence its pharmacokinetic properties. The presence of the azaspiro moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. Additionally, the compound's stability, reactivity, and interaction with biological systems can be influenced by the presence of the hydrochloride group. As with many nitrogen-containing heterocycles, it may also exhibit basicity, allowing it to form salts with acids. Overall, 7-Azaspiro[4.5]decane, hydrochloride is of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H17N.ClH
InChI:InChI=1S/C9H17N.ClH/c1-2-5-9(4-1)6-3-7-10-8-9;/h10H,1-8H2;1H
InChI key:InChIKey=KCCYNWHGDYJXPP-UHFFFAOYSA-N
SMILES:C12(CCCNC1)CCCC2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.