CAS 1198287-27-2
:4-(3,4-Dimethylphenyl)-1-methyl-4-piperidinol
Description:
4-(3,4-Dimethylphenyl)-1-methyl-4-piperidinol is an organic compound characterized by its piperidine structure, which includes a piperidinol moiety. This compound features a piperidine ring substituted with a methyl group and a 3,4-dimethylphenyl group, contributing to its unique chemical properties. The presence of the hydroxyl group (-OH) in the piperidinol structure indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The dimethylphenyl substituent can enhance lipophilicity, potentially affecting the compound's biological activity and pharmacokinetics. As a tertiary amine, it may exhibit basic properties, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's specific interactions, stability, and reactivity would depend on its environment, including factors such as pH and the presence of other chemical species. Overall, 4-(3,4-Dimethylphenyl)-1-methyl-4-piperidinol represents a complex organic molecule with potential implications in various chemical and biological contexts.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c1-11-4-5-13(10-12(11)2)14(16)6-8-15(3)9-7-14/h4-5,10,16H,6-9H2,1-3H3
InChI key:InChIKey=NUAVIMYDHHQWQZ-UHFFFAOYSA-N
SMILES:OC1(C2=CC(C)=C(C)C=C2)CCN(C)CC1
Synonyms:- 4-Piperidinol, 4-(3,4-dimethylphenyl)-1-methyl-
- 4-(3,4-Dimethylphenyl)-1-methyl-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.