CAS 1198287-28-3
:4-[4-(1,1-Dimethylethyl)phenyl]-1-(1-methylethyl)-4-piperidinol
Description:
4-[4-(1,1-Dimethylethyl)phenyl]-1-(1-methylethyl)-4-piperidinol, identified by its CAS number 1198287-28-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with various alkyl groups. This compound features a tert-butyl group and an isopropyl group, contributing to its hydrophobic characteristics. The presence of the piperidinol moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound's molecular structure may influence its solubility, stability, and reactivity, making it of interest in both synthetic and applied chemistry. Additionally, the steric hindrance introduced by the bulky substituents can affect its biological activity and pharmacokinetics. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties, which is crucial in the design of new chemical entities for therapeutic use.
Formula:C18H29NO
InChI:InChI=1S/C18H29NO/c1-14(2)19-12-10-18(20,11-13-19)16-8-6-15(7-9-16)17(3,4)5/h6-9,14,20H,10-13H2,1-5H3
InChI key:InChIKey=JYCZVDTYHYDKKN-UHFFFAOYSA-N
SMILES:OC1(C2=CC=C(C(C)(C)C)C=C2)CCN(C(C)C)CC1
Synonyms:- 4-Piperidinol, 4-[4-(1,1-dimethylethyl)phenyl]-1-(1-methylethyl)-
- 4-[4-(1,1-Dimethylethyl)phenyl]-1-(1-methylethyl)-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.