CAS 119830-32-9: 3-(N-Benzylamino)-L-alanine
Description:3-(N-Benzylamino)-L-alanine is an amino acid derivative characterized by the presence of a benzylamino group attached to the alpha carbon of L-alanine. This compound features both an amino group and a carboxylic acid group, typical of amino acids, which allows it to participate in various biochemical reactions. The benzylamino substituent enhances its lipophilicity compared to standard amino acids, potentially influencing its solubility and interaction with biological membranes. The presence of the chiral L-alanine configuration indicates that it exists in a specific stereoisomeric form, which is crucial for its biological activity. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or as a building block in peptide synthesis. Its unique structure could also allow for specific interactions with enzymes or receptors, making it a candidate for further investigation in medicinal chemistry. As with many amino acid derivatives, it may exhibit properties such as zwitterionic behavior in solution, depending on the pH of the environment.
Formula:C10H15N2O2
InChI:InChI=1/C10H14N2O2/c11-9(10(13)14)7-12-6-8-4-2-1-3-5-8/h1-5,9,12H,6-7,11H2,(H,13,14)/p+1/t9-/m0/s1
- Synonyms:
- Beta-N-Benzylamino-L-Ala
- (S)-2-Amino-3-(Benzylamino)Propanoic Acid
- 94%E.E.
- -N-Benzylamino-L-Ala
- Ss-N-Benzylamino-L-Ala
- L-β-(N-benzylamino) alanine
- (S)-2-Amino-3-(Benzylamino)Propanoic Acid 99% (94% E.E.)
- 3-(benzylamino)-L-alanine
- (2S)-2-ammonio-3-(benzylammonio)propanoate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | L-Alanine, 3-[(phenylmethyl)amino]- REF: IN-DA000PQWCAS: 119830-32-9 | - - - | To inquire | Tue 06 May 25 |
 | (2S)-2-Amino-3-(benzylamino)propanoic acid REF: 54-OR480345CAS: 119830-32-9 | - - - | To inquire | Mon 05 May 25 |
 | (S)-2-Amino-3-(benzylamino)propanoicacid REF: 3D-FA150642CAS: 119830-32-9 | Min. 95% | - - - | Discontinued product |
![L-Alanine, 3-[(phenylmethyl)amino]-](https://static.cymitquimica.com/products/IN/thumb/DA000PQW.jpg)
Ref: 54-OR480345
| Undefined size | To inquire |
(S)-2-Amino-3-(benzylamino)propanoicacid
Ref: 3D-FA150642
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
