CAS 1198300-79-6: 4-(Cyclopropylamino)-2-[[4-[4-(ethylsulfonyl)-1-piperazinyl]phenyl]amino]-5-pyrimidinecarboxamide
Description:4-(Cyclopropylamino)-2-[[4-[4-(ethylsulfonyl)-1-piperazinyl]phenyl]amino]-5-pyrimidinecarboxamide, identified by its CAS number 1198300-79-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrimidine core substituted with various functional groups. This compound features a cyclopropylamino group and a piperazine moiety, indicating potential interactions with biological targets, particularly in pharmacology. The presence of an ethylsulfonyl group suggests enhanced solubility and bioavailability, which are critical for therapeutic applications. The compound's structure implies it may exhibit properties such as enzyme inhibition or receptor modulation, making it a candidate for drug development. Its specific characteristics, including melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that could be explored for their potential medicinal properties, particularly in the context of treating various diseases.
Formula:C20H27N7O3S
InChI:InChI=1S/C20H27N7O3S/c1-2-31(29,30)27-11-9-26(10-12-27)16-7-5-15(6-8-16)24-20-22-13-17(18(21)28)19(25-20)23-14-3-4-14/h5-8,13-14H,2-4,9-12H2,1H3,(H2,21,28)(H2,22,23,24,25)
InChI key:InChIKey=BGLPECHZZQDNCD-UHFFFAOYSA-N
SMILES:O=C(N)C1=CN=C(N=C1NC2CC2)NC3=CC=C(C=C3)N4CCN(CC4)S(=O)(=O)CC
- Synonyms:
- 5-Pyrimidinecarboxamide, 4-(cyclopropylamino)-2-[[4-[4-(ethylsulfonyl)-1-piperazinyl]phenyl]amino]-
- PRT 062070
- PRT 2017
- Cerdulatinib
- 4-(Cyclopropylamino)-2-[[4-[4-(ethylsulfonyl)-1-piperazinyl]phenyl]amino]-5-pyrimidinecarboxamide
![4-(Cyclopropylamino)-2-[[4-[4-(ethylsulfonyl)-1-piperazinyl]phenyl]amino]-5-pyrimidinecarboxamide](https://static.cymitquimica.com/cas-image/313749-4-cyclopropylamino-2-4-4-ethylsulfonyl-1-piperazinyl-phenyl-amino-5-pyrimidinecarboxamide.png)
