CAS 119836-09-8

1-(4-Methylphenyl)-4-piperidinol

Description:

1-(4-Methylphenyl)-4-piperidinol, also known by its CAS number 119836-09-8, is an organic compound characterized by its piperidine ring structure substituted with a 4-methylphenyl group and a hydroxyl group. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic methylphenyl group. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structure allows for various functional modifications, which can lead to derivatives with altered properties. As with many piperidine derivatives, it may possess psychoactive or therapeutic effects, although specific applications would depend on further research and testing. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₇NO

InChI: InChI=1S/C12H17NO/c1-10-2-4-11(5-3-10)13-8-6-12(14)7-9-13/h2-5,12,14H,6-9H2,1H3

InChI key: InChIKey=PPQIXIPJWPTBBW-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)N2CCC(O)CC2

Synonyms:

• 1-(4-Methylphenyl)piperidin-4-ol
• 1-(4-Methylphenyl)-4-piperidinol
• 4-Piperidinol, 1-(4-methylphenyl)-