
CAS 119838-37-8
:Benzeneacetic acid, α-hydroxy-, (αR)-, compd. with (2R)-2-(1,1-dimethylethyl)-3-methyl-4-imidazolidinone (1:1)
Description:
Benzeneacetic acid, α-hydroxy-, (αR)-, compd. with (2R)-2-(1,1-dimethylethyl)-3-methyl-4-imidazolidinone (1:1), identified by CAS number 119838-37-8, is a chemical compound that features a combination of an α-hydroxy benzeneacetic acid and an imidazolidinone derivative. The α-hydroxy group contributes to its potential as a chiral compound, which may exhibit specific stereochemical properties. The imidazolidinone component is known for its role in various biological activities and may enhance the compound's solubility and stability. This compound is likely to exhibit moderate polarity due to the presence of both hydrophilic (carboxylic acid and hydroxyl) and hydrophobic (aromatic and aliphatic) groups. Its potential applications could span pharmaceuticals, where it may serve as an intermediate or active ingredient, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, its reactivity and interactions would depend on the functional groups present and the overall molecular structure. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C8H16N2O·C8H8O3
InChI:InChI=1S/C8H16N2O.C8H8O3/c1-8(2,3)7-9-5-6(11)10(7)4;9-7(8(10)11)6-4-2-1-3-5-6/h7,9H,5H2,1-4H3;1-5,7,9H,(H,10,11)/t2*7-/m11/s1
InChI key:InChIKey=XZXKXJSHUSGLJH-HFEGYEGKSA-N
SMILES:[C@](C)(C)(C)[C@H]1N(C)C(=O)CN1.[C@@H](C(O)=O)(O)C1=CC=CC=C1
Synonyms:- Benzeneacetic acid, α-hydroxy-, (R)-, compd. with (R)-2-(1,1-dimethylethyl)-3-methyl-4-imidazolidinone (1:1)
- 4-Imidazolidinone, 2-(1,1-dimethylethyl)-3-methyl-, (R)-, mono[(R)-α-hydroxybenzeneacetate]
- Benzeneacetic acid, α-hydroxy-, (αR)-, compd. with (2R)-2-(1,1-dimethylethyl)-3-methyl-4-imidazolidinone (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-2-(tert-Butyl)-3-methyl-4-oxoimidazolidin-1-ium (r)-2-hydroxy-2-phenylacetate
CAS:Formula:C16H24N2O4Molecular weight:308.3728
