CAS 119838-69-6
:Phenylmethyl 4-acetylbenzoate
Description:
Phenylmethyl 4-acetylbenzoate, also known by its CAS number 119838-69-6, is an organic compound characterized by its ester functional group. It features a phenylmethyl (benzyl) group attached to a 4-acetylbenzoate moiety, which contributes to its aromatic properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the acetyl group enhances its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, its aromatic nature may impart certain biological activities, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H14O3
InChI:InChI=1S/C16H14O3/c1-12(17)14-7-9-15(10-8-14)16(18)19-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3
InChI key:InChIKey=MJOALHSDHALYGJ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)C2=CC=C(C(C)=O)C=C2
Synonyms:- Benzoic acid, 4-acetyl-, phenylmethyl ester
- Benzyl 4-acetylbenzoate
- Phenylmethyl 4-acetylbenzoate
- 4-Acetylbenzoic acid benzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
