CAS 1198396-29-0

9-Bromo-11,11-dimethyl-11H-benzo[a]fluorene

Description:

9-Bromo-11,11-dimethyl-11H-benzo[a]fluorene is an organic compound characterized by its polycyclic aromatic structure, which includes a bromine substituent and two methyl groups at the 11-position of the benzo[a]fluorene framework. This compound typically exhibits properties common to polycyclic aromatic hydrocarbons, such as hydrophobicity and potential for π-π stacking interactions due to its planar structure. The presence of the bromine atom introduces additional reactivity, making it a useful intermediate in various organic synthesis applications, including the development of pharmaceuticals and agrochemicals. Its molecular structure may influence its electronic properties, potentially making it a candidate for studies in materials science, particularly in organic electronics or photonics. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and environmental conditions, which are important considerations for its practical applications. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with brominated organic compounds.

Formula: C₁₉H₁₅Br

InChI: InChI=1S/C19H15Br/c1-19(2)17-11-13(20)8-10-15(17)16-9-7-12-5-3-4-6-14(12)18(16)19/h3-11H,1-2H3

SMILES: CC1(C)c2cc(ccc2c2ccc3ccccc3c12)Br

Synonyms:

• 9-Bromine-11,11-Dimethyl-11H-Benzo[A]Fluorene

11H-Benzo[a]fluorene, 9-bromo-11,11-dimethyl-

CAS: 1198396-29-0

Formula: C₁₉H₁₅Br

Purity: 95%

Molecular weight: 323.2264

Ref: IN-DA000PR2