CAS 1198413-03-4

9-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one

Description:

9-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 9-position of the pyrido ring enhances its reactivity and potential for substitution reactions. This compound typically exhibits a solid-state at room temperature and is soluble in polar organic solvents, which is common for many nitrogen-containing heterocycles. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with similar compounds. The compound may also display interesting electronic properties owing to the conjugated system formed by the fused rings. Additionally, its synthesis and characterization can involve various methods, including cyclization reactions and halogenation processes. As with many heterocycles, understanding its reactivity and interactions with biological targets is crucial for exploring its potential applications in drug discovery and development.

Formula: C₈H₅ClN₂O

InChI: InChI=1S/C8H5ClN2O/c9-6-2-1-5-11-7(12)3-4-10-8(6)11/h1-5H

InChI key: InChIKey=OUKLJVNKIIWBEJ-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C(=O)C=CN2)C=CC1

Synonyms:

• 9-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one
• 4H-Pyrido[1,2-a]pyrimidin-4-one, 9-chloro-