CAS 1198413-10-3

8-Bromo-4H-pyrido[1,2-a]pyrimidin-4-one

Description:

8-Bromo-4H-pyrido[1,2-a]pyrimidin-4-one is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 8-position enhances its reactivity and can influence its biological activity. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, making it suitable for various chemical reactions and applications. Its structure allows for potential interactions with biological targets, which has garnered interest in medicinal chemistry. The compound may also display fluorescence properties, depending on its environment and substituents. As with many heterocycles, it may participate in nucleophilic and electrophilic reactions, making it versatile in synthetic organic chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 8-Bromo-4H-pyrido[1,2-a]pyrimidin-4-one is a compound of interest for research in both synthetic and medicinal chemistry.

Formula: C₈H₅BrN₂O

InChI: InChI=1S/C8H5BrN2O/c9-6-2-4-11-7(5-6)10-3-1-8(11)12/h1-5H

InChI key: InChIKey=CVYFPYSSTYXLMX-UHFFFAOYSA-N

SMILES: O=C1N2C(C=C(Br)C=C2)=NC=C1

Synonyms:

• 4H-Pyrido[1,2-a]pyrimidin-4-one, 8-bromo-
• 8-Bromo-4H-pyrido[1,2-a]pyrimidin-4-one

8-Bromo-pyrido[1,2-a]pyrimidin-4-one

CAS: 1198413-10-3

Versatile small molecule scaffold

Formula: C₈H₅BrN₂O

Purity: Min. 95%

Molecular weight: 225.04 g/mol

Ref: 3D-YXB41310