
CAS 1198413-17-0
:7-Bromo-1,8-naphthyridin-4(1H)-one
Description:
7-Bromo-1,8-naphthyridin-4(1H)-one is a heterocyclic compound characterized by the presence of a naphthyridine ring system, which is a bicyclic structure containing nitrogen atoms. The compound features a bromine substituent at the 7-position and a carbonyl group at the 4-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the bromine atom can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may also exhibit pharmacological properties, as many naphthyridine derivatives are known for their activity against various biological targets. Its molecular structure allows for potential interactions with enzymes or receptors, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 7-Bromo-1,8-naphthyridin-4(1H)-one is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-7-2-1-5-6(12)3-4-10-8(5)11-7/h1-4H,(H,10,11,12)
InChI key:InChIKey=PEXOJPNXNILGIR-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(Br)=CC2)=NC=C1
Synonyms:- 7-Bromo-1,8-naphthyridin-4(1H)-one
- 1,8-Naphthyridin-4(1H)-one, 7-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
