CAS 1198420-95-9

Methyl 5-cyanofuro[2,3-b]pyridine-2-carboxylate

Description:

Methyl 5-cyanofuro[2,3-b]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its complex structure, which includes a furo[2,3-b]pyridine framework. This compound features a cyano group (-CN) and a carboxylate ester (-COOCH3) functional group, contributing to its chemical reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the furo and pyridine rings suggests that it may exhibit interesting electronic properties and biological activity. Typically, compounds of this nature are studied for their potential as pharmaceuticals or agrochemicals due to their ability to interact with biological systems. The compound's solubility, stability, and reactivity can vary based on the specific conditions, such as pH and solvent used. Additionally, its molecular structure may allow for various substitution reactions, making it a versatile intermediate in synthetic chemistry. Overall, Methyl 5-cyanofuro[2,3-b]pyridine-2-carboxylate represents a valuable compound in the field of organic chemistry with potential applications in drug development and material science.

Formula: C₁₀H₆N₂O₃

InChI: InChI=1S/C10H6N2O3/c1-14-10(13)8-3-7-2-6(4-11)5-12-9(7)15-8/h2-3,5H,1H3

InChI key: InChIKey=IGTQQBWAEUZZLA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=2C(O1)=NC=C(C#N)C2

Synonyms:

• Furo[2,3-b]pyridine-2-carboxylic acid, 5-cyano-, methyl ester
• Methyl 5-cyanofuro[2,3-b]pyridine-2-carboxylate