CAS 1198436-65-5

Ethyl 2-methyl-5-(1-methylethyl)-4-thiazolecarboxylate

Description:

Ethyl 2-methyl-5-(1-methylethyl)-4-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the 2-methyl and 5-(1-methylethyl) substituents on the thiazole ring indicates that it has branched alkyl groups, which can influence its physical properties, such as boiling point and solubility. Ethyl 2-methyl-5-(1-methylethyl)-4-thiazolecarboxylate may exhibit biological activity, making it of interest in pharmaceutical and agricultural applications. Its molecular structure suggests potential interactions with biological systems, possibly serving as a precursor or intermediate in the synthesis of more complex molecules. As with many thiazole derivatives, it may also possess unique chemical reactivity due to the electron-withdrawing nature of the thiazole ring, which can affect its behavior in various chemical reactions.

Formula: C₁₀H₁₅NO₂S

InChI: InChI=1S/C10H15NO2S/c1-5-13-10(12)8-9(6(2)3)14-7(4)11-8/h6H,5H2,1-4H3

InChI key: InChIKey=LHJMNQMQHPCNKS-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(C(C)C)SC(C)=N1

Synonyms:

• 4-Thiazolecarboxylic acid, 2-methyl-5-(1-methylethyl)-, ethyl ester
• Ethyl 2-methyl-5-(1-methylethyl)-4-thiazolecarboxylate