CAS 1198439-06-3

1-Methyl-5-(4-morpholinylmethyl)-1H-pyrazole-3-carboxylic acid

Description:

1-Methyl-5-(4-morpholinylmethyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity in various chemical reactions. The morpholine moiety, a six-membered ring containing both oxygen and nitrogen, enhances the compound's solubility and may influence its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Its molecular structure suggests that it may exhibit properties such as moderate lipophilicity and the ability to form hydrogen bonds, which are important for drug-like characteristics. Additionally, the methyl group at the 1-position of the pyrazole ring may affect its steric and electronic properties, influencing its overall reactivity and interactions in biological systems.

Formula: C₁₀H₁₅N₃O₃

InChI: InChI=1S/C10H15N3O3/c1-12-8(6-9(11-12)10(14)15)7-13-2-4-16-5-3-13/h6H,2-5,7H2,1H3,(H,14,15)

InChI key: InChIKey=WGLLACIEQFPTFM-UHFFFAOYSA-N

SMILES: C(C1=CC(C(O)=O)=NN1C)N2CCOCC2

Synonyms:

• 1-Methyl-5-(morpholinomethyl)-1H-pyrazole-3-carboxylic acid
• 1-Methyl-5-(4-morpholinylmethyl)-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 1-methyl-5-(4-morpholinylmethyl)-