CAS 1198466-20-4

1,1-Dimethylethyl 9-amino-3-azabicyclo[3.3.1]nonane-3-carboxylate

Description:

1,1-Dimethylethyl 9-amino-3-azabicyclo[3.3.1]nonane-3-carboxylate, identified by its CAS number 1198466-20-4, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system, contributing to its classification as an azabicyclic compound. The presence of the dimethyl group indicates that it has branched alkyl substituents, which can influence its steric properties and reactivity. The amino group suggests potential for hydrogen bonding and reactivity in various chemical environments, while the carboxylate moiety indicates acidic properties and potential for salt formation. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific functional groups and the overall molecular structure, which can affect its interactions in biological systems or chemical reactions. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15-7-9-5-4-6-10(8-15)11(9)14/h9-11H,4-8,14H2,1-3H3

InChI key: InChIKey=QOQQKPHJTZRKSK-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2C(N)C(C1)CCC2

Synonyms:

• 1,1-Dimethylethyl 9-amino-3-azabicyclo[3.3.1]nonane-3-carboxylate
• 3-Azabicyclo[3.3.1]nonane-3-carboxylic acid, 9-amino-, 1,1-dimethylethyl ester