CymitQuimica logo

CAS 1198475-40-9

:

6-Bromo-2-(methylthio)thieno[2,3-d]pyrimidin-4(1H)-one

Description:
6-Bromo-2-(methylthio)thieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its unique structural features, which include a thieno[2,3-d]pyrimidine core. This compound contains a bromine atom at the 6-position and a methylthio group at the 2-position, contributing to its chemical reactivity and potential biological activity. The presence of the thieno and pyrimidine rings suggests that it may exhibit properties typical of both aromatic and heteroaromatic compounds, such as stability and the ability to participate in various chemical reactions, including nucleophilic substitutions. The compound's structure may also influence its solubility, melting point, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the bromine substituent can enhance the compound's lipophilicity and may play a role in its pharmacokinetic properties. Overall, 6-Bromo-2-(methylthio)thieno[2,3-d]pyrimidin-4(1H)-one represents a class of compounds that could have significant applications in pharmaceuticals and agrochemicals.
Formula:C7H5BrN2OS2
InChI:InChI=1S/C7H5BrN2OS2/c1-12-7-9-5(11)3-2-4(8)13-6(3)10-7/h2H,1H3,(H,9,10,11)
InChI key:InChIKey=IOHONOJVTPAGLZ-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(SC)=N1)SC(Br)=C2
Synonyms:
  • 6-Bromo-2-(methylthio)thieno[2,3-d]pyrimidin-4(1H)-one
  • Thieno[2,3-d]pyrimidin-4(1H)-one, 6-bromo-2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.