CAS 1198475-45-4

5-Bromo-3-iodo-2-methoxybenzoic acid

Description:

5-Bromo-3-iodo-2-methoxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with bromine, iodine, and a methoxy group. The presence of the bromine and iodine atoms introduces significant halogen characteristics, influencing the compound's reactivity and potential applications in organic synthesis. The methoxy group contributes to the compound's polarity and can affect its solubility in various solvents. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Additionally, the halogen substituents can enhance the compound's electrophilicity, making it a useful intermediate in the synthesis of more complex organic molecules. Its unique combination of substituents may also impart specific biological activities, making it of interest in pharmaceutical research. Overall, 5-Bromo-3-iodo-2-methoxybenzoic acid is a versatile compound with potential applications in both synthetic chemistry and medicinal chemistry.

Formula: C₈H₆BrIO₃

InChI: InChI=1S/C8H6BrIO3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=KEQKAEQOVTURLS-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(O)=O)C=C(Br)C=C1I

Synonyms:

• 5-Bromo-3-iodo-2-methoxybenzoic acid
• Benzoic acid, 5-bromo-3-iodo-2-methoxy-