CAS 119851-28-4

1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone

Description:

1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone, with the CAS number 119851-28-4, is an organic compound characterized by its complex aromatic structure. It features a phenyl ring substituted with both chlorine and a phenoxy group, contributing to its chemical reactivity and potential applications. The presence of the ethanone functional group indicates that it is a ketone, which typically exhibits properties such as being a polar compound with a carbonyl group that can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its chlorinated structure can influence its solubility, stability, and interaction with biological systems. Additionally, the compound's synthesis and handling require careful consideration due to the presence of chlorine atoms, which can impart toxicity and environmental concerns. Overall, 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone is a noteworthy compound in organic chemistry with potential applications in various fields, including medicinal chemistry and agrochemicals.

Formula: C₁₄H₁₀Cl₂O₂

InChI: InChI=1S/C14H10Cl2O2/c1-9(17)13-7-6-12(8-14(13)16)18-11-4-2-10(15)3-5-11/h2-8H,1H3

InChI key: InChIKey=BDTJIVUVQRVLLJ-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(Cl)C=C(OC2=CC=C(Cl)C=C2)C=C1

Synonyms:

• 1-[2-Chloro-4-(4-Chlorophenoxy)Phenyl]Ethanone
• 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one
• 4-(4-Chlorophenoxy)-2-Chloroacetophenone
• Ethanone, 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-
• 2-Chloro-4-(4-chlorophenoxy)acetophenone

Ethanone, 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-

CAS: 119851-28-4

Formula: C₁₄H₁₀Cl₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 281.1340

Ref: IN-DA000PS4

1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one

CAS: 119851-28-4

1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one

Formula: C₁₄H₁₀Cl₂O₂

Purity: 98%

Color and Shape: white to off-white crystalline powder

Molecular weight: 281.134g/mol

Ref: 54-OR1532

2'-Chloro-4'-(4-chlorophenoxy)acetophenone

CAS: 119851-28-4

Formula: C₁₄H₁₀Cl₂O₂

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 281.13

Ref: 3B-C2219

1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one

CAS: 119851-28-4

1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one is an organic compound that belongs to the class of condensation products. It is a high purity product that is extracted from substances with high boiling points and crystallizes easily. This chemical reacts with ketones or alkoxides in a condensation reaction to form esters, ethers, ketals, or acetals. 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one can be used as an additive for fungicides such as difenoconazole.

Formula: C₁₄H₁₀Cl₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 281.13 g/mol

Ref: 3D-FC37595

2′-Chloro-4′-(4-chlorophenoxy)acetophenone

CAS: 119851-28-4

Formula: C₁₄H₁₀Cl₂O₂

Purity: 98%

Molecular weight: 281.13

Ref: 10-F068317