CAS 1198569-36-6
:Ethyl 3-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate
Description:
Ethyl 3-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes both imidazole and pyridine rings. This compound features a bromine atom and a nitro group, contributing to its reactivity and potential biological activity. The ethyl ester functional group enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and drug development. The presence of the nitro group may impart specific electronic properties, influencing the compound's interaction with biological targets. Additionally, the bromine substituent can facilitate further chemical modifications, allowing for the synthesis of derivatives with tailored properties. Overall, this compound is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features and potential for biological activity. As with any chemical, proper handling and safety protocols should be observed, given the potential hazards associated with its components.
Formula:C10H8BrN3O4
InChI:InChI=1S/C10H8BrN3O4/c1-2-18-10(15)8-9(11)13-5-6(14(16)17)3-4-7(13)12-8/h3-5H,2H2,1H3
InChI key:InChIKey=LFMWDQFGDBAUIL-UHFFFAOYSA-N
SMILES:BrC=1N2C(=NC1C(OCC)=O)C=CC(N(=O)=O)=C2
Synonyms:- Ethyl 3-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate
- Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-bromo-6-nitro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.