CymitQuimica logo

CAS 1198569-37-7

:

4-Chloropyrido[3′,2′:4,5]furo[3,2-d]pyrimidine

Description:
4-Chloropyrido[3′,2′:4,5]furo[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex fused ring structure, which incorporates both pyridine and pyrimidine moieties along with a furan ring. This compound features a chlorine substituent at the 4-position of the pyridine ring, which can influence its reactivity and biological activity. The presence of multiple nitrogen atoms in the structure contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various properties such as solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom. Additionally, its structural complexity may lead to interesting interactions with biological targets, making it a subject of interest in drug discovery and development. As with many heterocycles, the specific characteristics such as melting point, boiling point, and spectral properties would need to be determined experimentally or sourced from chemical databases for precise applications.
Formula:C9H4ClN3O
InChI:InChI=1S/C9H4ClN3O/c10-8-7-6(12-4-13-8)5-2-1-3-11-9(5)14-7/h1-4H
InChI key:InChIKey=UFTANKSBYMFUPC-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=3C(O2)=NC=CC3)=NC=N1
Synonyms:
  • Pyrido[3′,2′:4,5]furo[3,2-d]pyrimidine, 4-chloro-
  • 4-Chloropyrido[3′,2′:4,5]furo[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.