CAS 1198569-38-8

Methyl 6-bromo-4-chloro-8-quinolinecarboxylate

Description:

Methyl 6-bromo-4-chloro-8-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of bromine and chlorine substituents on the quinoline ring enhances its potential for various chemical reactions, including electrophilic aromatic substitution and cross-coupling reactions. The compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. Its molecular structure suggests it may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would depend on further empirical studies. As with many halogenated compounds, it is essential to handle this substance with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this compound in laboratory settings.

Formula: C₁₁H₇BrClNO₂

InChI: InChI=1S/C11H7BrClNO2/c1-16-11(15)8-5-6(12)4-7-9(13)2-3-14-10(7)8/h2-5H,1H3

InChI key: InChIKey=UMFBRWYXTCUBMJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(C=C(Br)C1)C(Cl)=CC=N2

Synonyms:

• Methyl 6-bromo-4-chloro-8-quinolinecarboxylate
• 8-Quinolinecarboxylic acid, 6-bromo-4-chloro-, methyl ester