CAS 1198569-39-9

6-Bromo-4-iodo-5-(phenylmethoxy)-2-pyridinemethanol

Description:

6-Bromo-4-iodo-5-(phenylmethoxy)-2-pyridinemethanol is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine and iodine atoms, as well as a phenylmethoxy group. The presence of these halogen substituents typically influences the compound's reactivity and solubility, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The phenylmethoxy group can enhance the lipophilicity of the molecule, which may affect its biological activity and interactions with other compounds. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the hydroxymethyl group that can participate in hydrogen bonding. Additionally, the specific arrangement of substituents can lead to unique electronic properties, impacting its behavior in different chemical environments. Overall, 6-Bromo-4-iodo-5-(phenylmethoxy)-2-pyridinemethanol represents a versatile structure with potential applications in organic synthesis and drug development.

Formula: C₁₃H₁₁BrINO₂

InChI: InChI=1S/C13H11BrINO2/c14-13-12(11(15)6-10(7-17)16-13)18-8-9-4-2-1-3-5-9/h1-6,17H,7-8H2

InChI key: InChIKey=UONIVNSGZDAIPR-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C=2C(I)=CC(CO)=NC2Br

Synonyms:

• 2-Pyridinemethanol, 6-bromo-4-iodo-5-(phenylmethoxy)-
• 6-Bromo-4-iodo-5-(phenylmethoxy)-2-pyridinemethanol

[5-(Benzyloxy)-6-bromo-4-iodo-2-pyridinyl]methanol

CAS: 1198569-39-9

[5-(Benzyloxy)-6-bromo-4-iodo-2-pyridinyl]methanol

Purity: ≥95%

Molecular weight: 420.04g/mol

Ref: 54-OR303872