CAS 119858-52-5

2-Methylimidazo[1,2-a]pyridine-8-amine

Description:

2-Methylimidazo[1,2-a]pyridine-8-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, with a methyl group and an amino group attached to the structure. This compound is known for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, as it is a derivative of imidazoquinoline compounds often found in cooked meats and certain food products. The presence of the amino group contributes to its reactivity and potential interactions with biological macromolecules. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The compound's molecular structure allows for various chemical reactions, making it of interest in both synthetic organic chemistry and pharmacological research. Safety data indicate that it should be handled with care due to its potential health risks. Overall, 2-Methylimidazo[1,2-a]pyridine-8-amine serves as an important subject of study in toxicology and environmental chemistry.

Formula: C₈H₉N₃

InChI: InChI=1/C8H9N3/c1-6-5-11-4-2-3-7(9)8(11)10-6/h2-5H,9H2,1H3

SMILES: Cc1cn2cccc(c2n1)N

Synonyms:

• 2-Methylimidazo[1,2-a]pyridin-8-amine
• Imidazo[1,2-a]pyridin-8-amine, 2-methyl-

Imidazo[1,2-a]pyridin-8-amine, 2-methyl-

CAS: 119858-52-5

Formula: C₈H₉N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 147.1772

Ref: IN-DA000PS1

2-Methylimidazo[1,2-a]pyridin-8-amine

CAS: 119858-52-5

2-Methylimidazo[1,2-a]pyridin-8-amine

Purity: 98%

Molecular weight: 147.18g/mol

Ref: 54-OR93051

2-Methylimidazo[1,2-a]pyridin-8-amine

CAS: 119858-52-5

Purity: 97%

Molecular weight: 147.18

Ref: 10-F766700