CAS 1198615-61-0

Methyl 2,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-benzofurancarboxylate

Description:

Methyl 2,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-benzofurancarboxylate is a complex organic compound characterized by its unique structural features, including a benzofuran moiety and a dioxaborolane group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the dioxaborolane group suggests that it may participate in various chemical reactions, such as Suzuki coupling, which is significant in organic synthesis and materials science. The methyl ester functional group indicates that it may be involved in esterification reactions and could serve as a precursor for further chemical modifications. Additionally, the compound's molecular structure may impart specific solubility characteristics, influencing its behavior in different solvents. Overall, this compound's unique features make it of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and advanced materials.

Formula: C₁₆H₂₁BO₅

InChI: InChI=1S/C16H21BO5/c1-15(2)16(3,4)22-17(21-15)11-8-10-6-7-20-13(10)12(9-11)14(18)19-5/h8-9H,6-7H2,1-5H3

InChI key: InChIKey=LZKKMKQHUZIMSE-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC(=C1)B3OC(C)(C)C(C)(C)O3)CCO2

Synonyms:

• 7-Benzofurancarboxylic acid, 2,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester
• Methyl 2,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-benzofurancarboxylate