
CAS 1198615-89-2
:Ethyl 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetate
Description:
Ethyl 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetate is a chemical compound characterized by its complex structure, which includes a fluorine atom and a boron-containing moiety. The presence of the ethyl ester functional group indicates that it can participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. The fluorine atom contributes to the compound's potential reactivity and lipophilicity, which can influence its behavior in biological systems and its utility in synthetic applications. The dioxaborolane group is notable for its role in organoboron chemistry, often utilized in cross-coupling reactions, making this compound potentially valuable in organic synthesis and medicinal chemistry. Its unique structural features may also impart specific physical properties, such as solubility and boiling point, which are essential for its application in various chemical processes. Overall, this compound exemplifies the intersection of fluorinated compounds and organoboron chemistry, highlighting its potential in advanced synthetic methodologies.
Formula:C16H22BFO4
InChI:InChI=1S/C16H22BFO4/c1-6-20-14(19)10-11-9-12(7-8-13(11)18)17-21-15(2,3)16(4,5)22-17/h7-9H,6,10H2,1-5H3
InChI key:InChIKey=AZRMRGFTXPQBLK-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(CC(OCC)=O)=C(F)C=C2
Synonyms:- Ethyl 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetate
- Benzeneacetic acid, 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-(2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate
CAS:Formula:C16H22BFO4Molecular weight:308.1529
