CAS 119868-24-5
:1-PHENYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-4-OL
Description:
1-Phenyl-3-(trifluoromethyl)-1H-pyrazol-4-ol is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a phenyl group and a trifluoromethyl group significantly influences its chemical properties and reactivity. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. The trifluoromethyl group enhances its lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the hydroxyl group at the 4-position of the pyrazole ring contributes to its potential as a hydrogen bond donor, which can play a crucial role in interactions with biological targets. The compound may also exhibit interesting thermal and spectral properties, making it suitable for various applications in pharmaceuticals and agrochemicals. As with many pyrazole derivatives, it may possess anti-inflammatory or analgesic properties, although specific biological activities would require further investigation.
Formula:C10H7F3N2O
InChI:InChI=1/C10H7F3N2O/c11-10(12,13)9-8(16)6-15(14-9)7-4-2-1-3-5-7/h1-6,16H
SMILES:c1ccc(cc1)n1cc(c(C(F)(F)F)n1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Phenyl-3-(trifluoromethyl)-1H-pyrazol-4-ol
CAS:Formula:C10H7F3N2OColor and Shape:SolidMolecular weight:228.1706
