CymitQuimica logo

CAS 119868-25-6

:

5-Methyl-1-phenyl-3-(trifluoromethyl)-1H-pyrazol-4-ol

Description:
5-Methyl-1-phenyl-3-(trifluoromethyl)-1H-pyrazol-4-ol is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a phenyl group, contributing to its hydrophobic characteristics, while the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and biological activity. The presence of the hydroxyl group (-OH) at the 4-position of the pyrazole ring suggests potential for hydrogen bonding, which can affect solubility and interaction with other molecules. The trifluoromethyl group is known for imparting unique electronic properties, making the compound potentially useful in medicinal chemistry and material science. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would need to be investigated through empirical studies. Overall, the structural features of 5-Methyl-1-phenyl-3-(trifluoromethyl)-1H-pyrazol-4-ol suggest a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H9F3N2O
InChI:InChI=1S/C11H9F3N2O/c1-7-9(17)10(11(12,13)14)15-16(7)8-5-3-2-4-6-8/h2-6,17H,1H3
InChI key:InChIKey=YOHTWWBAMZHHLC-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C(F)(F)F)C1O)C2=CC=CC=C2
Synonyms:
  • 1H-Pyrazol-4-ol, 5-methyl-1-phenyl-3-(trifluoromethyl)-
  • 5-Methyl-1-phenyl-3-(trifluoromethyl)-1H-pyrazol-4-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.