
CAS 1198795-16-2
:1-(Tetrahydro-1(2H)-pyrimidinyl)ethanone
Description:
1-(Tetrahydro-1(2H)-pyrimidinyl)ethanone, identified by its CAS number 1198795-16-2, is a chemical compound characterized by its unique structure, which includes a tetrahydropyrimidine ring fused with an ethanone moiety. This compound typically exhibits properties associated with both cyclic amines and ketones, making it of interest in various chemical and pharmaceutical applications. The presence of the tetrahydropyrimidine ring suggests potential biological activity, as many compounds with similar structures are known to interact with biological targets. Its molecular structure may contribute to its solubility in organic solvents, while its functional groups can influence reactivity and stability. Additionally, the compound may be synthesized through specific organic reactions, allowing for modifications that can enhance its properties or biological activity. Overall, 1-(Tetrahydro-1(2H)-pyrimidinyl)ethanone represents a versatile building block in organic synthesis and medicinal chemistry, warranting further investigation into its potential applications.
Formula:C6H12N2O
InChI:InChI=1S/C6H12N2O/c1-6(9)8-4-2-3-7-5-8/h7H,2-5H2,1H3
InChI key:InChIKey=TUQCQDGVISPJNE-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CCCNC1
Synonyms:- Ethanone, 1-(tetrahydro-1(2H)-pyrimidinyl)-
- 1-(Tetrahydro-1(2H)-pyrimidinyl)ethanone
- 1-(Tetrahydropyrimidin-1-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.