CymitQuimica logo

CAS 119881-02-6

:

Boc-Aminomalonic acid

Description:
Boc-Aminomalonic acid, with the CAS number 119881-02-6, is a chemical compound characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group attached to an aminomalonic acid structure. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The Boc group serves to protect the amine functionality during chemical reactions, making it a valuable intermediate in peptide synthesis and other organic transformations. The aminomalonic acid moiety features two carboxylic acid groups and an amine, which can participate in various chemical reactions, including coupling reactions and the formation of amides. Its structure allows for the potential formation of diverse derivatives, making it useful in medicinal chemistry and the development of pharmaceuticals. Additionally, Boc-Aminomalonic acid is often utilized in the synthesis of biologically active compounds due to its ability to introduce functional groups selectively. Proper handling and storage conditions are essential, as with many chemical substances, to ensure stability and safety.
Formula:C8H13NO6
InChI:InChI=1S/C8H13NO6/c1-8(2,3)15-7(14)9-4(5(10)11)6(12)13/h4H,1-3H3,(H,9,14)(H,10,11)(H,12,13)
InChI key:QDOUGIFZJJVBOL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(C(=O)O)C(=O)O
Synonyms:
  • Propanedioic acid, [[(1,1-dimethylethoxy)carbonyl]amino]-
Found 4 products.