CAS 1199-00-4
:3-METHYL-5-PHENYL-1,2,4-OXADIAZOLE
Description:
3-Methyl-5-phenyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by a five-membered ring containing two nitrogen atoms and three carbon atoms, along with an oxygen atom. This compound features a methyl group and a phenyl group, which contribute to its unique chemical properties and potential applications. The presence of the oxadiazole ring imparts notable stability and reactivity, making it of interest in various fields, including pharmaceuticals and materials science. It is often studied for its potential as a building block in the synthesis of more complex molecules, as well as for its possible biological activities. The compound may exhibit fluorescence and other electronic properties due to its conjugated system, which can be advantageous in optoelectronic applications. Additionally, its solubility and reactivity can vary depending on the solvent and conditions, influencing its utility in chemical reactions and formulations. Overall, 3-methyl-5-phenyl-1,2,4-oxadiazole is a versatile compound with significant implications in both research and industrial applications.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-7-10-9(12-11-7)8-5-3-2-4-6-8/h2-6H,1H3
SMILES:Cc1nc(c2ccccc2)on1
Synonyms:- 3-Methyl-5-phenyl-1,2,4-oxadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2,4-Oxadiazole, 3-methyl-5-phenyl-
CAS:Formula:C9H8N2OPurity:98%Color and Shape:SolidMolecular weight:160.17263-Methyl-5-phenyl-1,2,4-oxadiazole
CAS:3-Methyl-5-phenyl-1,2,4-oxadiazolePurity:98%Molecular weight:160.17g/mol3-Methyl-5-phenyl-1,2,4-oxadiazole
CAS:3-Methyl-5-phenyl-1,2,4-oxadiazole is an organic compound that has been synthesized from aminoacids. It is a mesoionic heterocyclic compound with the chemical formula CHNO. 3-Methyl-5-phenyl-1,2,4-oxadiazole is a dipolarophile and can be used in cycloaddition reactions with nitrosobenzene to produce nitrostyrenes. 3-Methyl-5-phenyl-1,2,4-oxadiazole can also be synthesized by using diazomethane as a reagent and a regiospecific process.
Formula:C9H8N2OPurity:Min. 95%Molecular weight:160.17 g/mol



