CAS 1199-01-5
:Azlactone
Description:
Azlactone, identified by its CAS number 1199-01-5, is a cyclic compound characterized by a five-membered lactone structure that contains an imine functional group. This compound typically exhibits a white to pale yellow solid appearance and is known for its reactivity, particularly in the context of polymer chemistry and organic synthesis. Azlactones are notable for their ability to undergo ring-opening reactions, which can lead to the formation of various derivatives and polymers. They are often utilized as intermediates in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to their versatile reactivity. Additionally, azlactones can participate in nucleophilic addition reactions, making them valuable in the development of new materials and compounds. Their stability can vary depending on the substituents present on the ring, influencing their chemical behavior and applications. Overall, azlactones represent an important class of compounds in organic chemistry with significant implications in various industrial and research applications.
Formula:C9H7NO2
InChI:InChI=1S/C9H7NO2/c11-8-6-10-9(12-8)7-4-2-1-3-5-7/h1-5H,6H2
InChI key:InChIKey=QKCKCXFWENOGER-UHFFFAOYSA-N
SMILES:O=C1OC(=NC1)C2=CC=CC=C2
Synonyms:- 2-Oxazolin-5-one, 2-phenyl-
- 2-Phenyl-1,3-Oxazolidin-5-One
- 2-Phenyl-2-oxazolin-5-one
- 2-Phenyl-4,5-dihydro-1,3-oxazol-5-one
- 2-Phenyl-4,5-dihydro-5-oxazolone
- 2-Phenyl-4H-1,3-oxazol-5-one
- 2-Phenyl-4H-oxazol-5-one
- 2-Phenyl-5(4H)-oxazolone
- 2-Phenyloxazol-5(4H)-one
- 2-phenyl-1,3-oxazol-5(4H)-one
- 5(4H)-Oxazolone, 2-phenyl-
- Azlactone
- NSC 79500
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Phenyl-5-oxazolone, 97%
CAS:2-Phenyl-5-oxazolone is a reagent used as a masked glycine equivalent and for the formation of heterocyclic structures, it can be used to produce 4-benzylidene-2-phenyl-4H-oxazol-5-one. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documFormula:C9H7NO2Purity:97%Color and Shape:Cream to yellow to orange to red to brown or pink, Crystals or powder or crystalline powder or fused solid or granulesMolecular weight:161.165(4H)-Oxazolone, 2-phenyl-
CAS:Formula:C9H7NO2Purity:95%Color and Shape:SolidMolecular weight:161.15742-Phenyl-5-oxazolone
CAS:2-Phenyl-5-oxazolone is a chemical compound that has been used as a starting material for the synthesis of various other organic compounds. It can be synthesized by the reaction of 2-phenylacetamide with 3-chloro-5,6-dihydrobenzoxazole. The kinetic data for this reaction are provided in the table below. Monoclonal antibodies have been used to detect and quantify 2-phenyl-5-oxazolone in human urine samples, but it is not yet known whether this compound plays any role in the development of prostate cancer cells. Caproic acid is a metabolite that is formed from 2-phenylacetamide during its conversion to 2-phenyl 5 oxazolone.
Formula:C9H7NO2Purity:Min. 95%Molecular weight:161.16 g/mol




