
CAS 1199-05-9
:3,4-Dihydro-6-methyl-2H-1,3-benzoxazin-2-one
Description:
3,4-Dihydro-6-methyl-2H-1,3-benzoxazin-2-one, with the CAS number 1199-05-9, is a heterocyclic organic compound characterized by its benzoxazine structure. This compound features a fused benzene and oxazine ring, which contributes to its unique chemical properties. It is typically a colorless to pale yellow solid at room temperature and is known for its moderate solubility in organic solvents. The presence of a methyl group at the 6-position and the dihydro configuration enhances its stability and reactivity. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in polymer chemistry. Its derivatives may exhibit antimicrobial, anti-inflammatory, or antioxidant properties, making it a subject of research for therapeutic uses. Additionally, the structural features of 3,4-Dihydro-6-methyl-2H-1,3-benzoxazin-2-one allow for further functionalization, which can lead to the development of novel compounds with tailored properties.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c1-6-2-3-8-7(4-6)5-10-9(11)12-8/h2-4H,5H2,1H3,(H,10,11)
InChI key:InChIKey=MMKYXYZMUHIHJF-UHFFFAOYSA-N
SMILES:CC=1C=C2C(OC(=O)NC2)=CC1
Synonyms:- 2H-1,3-Benzoxazin-2-one, 3,4-dihydro-6-methyl-
- 3,4-Dihydro-6-methyl-2H-1,3-benzoxazin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
