CAS 1199-08-2
:2-Ethyl-1,4-dimethoxybenzene
Description:
2-Ethyl-1,4-dimethoxybenzene, also known as p-ethoxy-dimethoxybenzene, is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two methoxy groups (-OCH3) and an ethyl group (-C2H5). This compound is typically a colorless to pale yellow liquid with a sweet, pleasant odor. It is relatively non-polar due to the presence of the ethyl and methoxy groups, which influence its solubility in organic solvents while rendering it less soluble in water. The presence of methoxy groups enhances its electron-donating properties, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, 2-Ethyl-1,4-dimethoxybenzene can be utilized in the synthesis of more complex organic molecules and may exhibit interesting biological activities, although specific data on its toxicity and environmental impact may be limited. As with many organic compounds, proper handling and safety precautions are essential when working with this substance in a laboratory setting.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c1-4-8-7-9(11-2)5-6-10(8)12-3/h5-7H,4H2,1-3H3
InChI key:InChIKey=CCZCWRYUYQRBPE-UHFFFAOYSA-N
SMILES:C(C)C1=C(OC)C=CC(OC)=C1
Synonyms:- 1,4-Dimethoxy-2-ethylbenzene
- Benzene, 2-ethyl-1,4-dimethoxy-
- 2-Ethyl-1,4-dimethoxybenzene
- 3-Methyl-4-(2,5-dimethoxyphenyl)methyleneisoxazole-5(4H)-one
- 2,5-DIMETHOXYETHYLBENZENE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
