
CAS 1199-30-0
:2-[(2-Chlorophenyl)methoxy]ethanol
Description:
2-[(2-Chlorophenyl)methoxy]ethanol, with the CAS number 1199-30-0, is an organic compound characterized by its ether and alcohol functional groups. It features a chlorinated phenyl group attached to a methoxy group, which is further linked to an ethanol moiety. This structure imparts both hydrophilic and lipophilic properties, making it soluble in various organic solvents while also exhibiting some solubility in water. The presence of the chlorine atom enhances its reactivity and can influence its biological activity. The compound is typically used in chemical synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and melting point, can vary based on purity and environmental conditions. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage and disposal methods are essential to mitigate risks associated with its use.
Formula:C9H11ClO2
InChI:InChI=1S/C9H11ClO2/c10-9-4-2-1-3-8(9)7-12-6-5-11/h1-4,11H,5-7H2
InChI key:InChIKey=PJWBNHPIMROMAC-UHFFFAOYSA-N
SMILES:C(OCCO)C1=C(Cl)C=CC=C1
Synonyms:- Ethanol, 2-[(o-chlorobenzyl)oxy]-
- 2-[(2-Chlorophenyl)methoxy]ethanol
- Ethanol, 2-[(2-chlorophenyl)methoxy]-
- 2-[(2-Chlorobenzyl)oxy]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.