
CAS 1199-72-0
:3-Azabicyclo[3.2.2]nonane-3-ethanamine
Description:
3-Azabicyclo[3.2.2]nonane-3-ethanamine, with the CAS number 1199-72-0, is a bicyclic amine compound characterized by its unique bicyclic structure that incorporates a nitrogen atom within the ring system. This compound features a bicyclic framework consisting of nine total carbon atoms and one nitrogen atom, which contributes to its rigidity and potential for specific interactions with biological targets. The presence of an ethylamine side chain at the 3-position enhances its basicity and solubility in polar solvents, making it relevant in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features may influence its pharmacological properties, including receptor binding affinity and selectivity. Additionally, the compound's stereochemistry can play a significant role in its biological activity, as different conformations may interact differently with biological systems. Overall, 3-Azabicyclo[3.2.2]nonane-3-ethanamine is of interest for its potential applications in drug design and synthesis, particularly in the context of neuropharmacology and other therapeutic areas.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c11-5-6-12-7-9-1-2-10(8-12)4-3-9/h9-10H,1-8,11H2
InChI key:InChIKey=CMDZCNVXUJPTRB-UHFFFAOYSA-N
SMILES:C(CN)N1CC2CCC(C1)CC2
Synonyms:- 3-Azabicyclo[3.2.2]nonane-3-ethanamine
- 3-Azabicyclo[3.2.2]nonane, 3-(2-aminoethyl)-
- 3-(2-Aminoethyl)-3-azabicyclo[3.2.2]nonane
- 2-(3-Azabicyclo[3.2.2]non-3-yl)ethylamine
- N-(2-Aminoethyl)-3-azabicyclo[3.2.2]nonane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.