CAS 1199-90-2
:1-but-3-enyl-3-methoxy-benzene
Description:
1-But-3-enyl-3-methoxy-benzene, also known by its CAS number 1199-90-2, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a butenyl side chain. This compound features a benzene ring substituted at the 3-position with a methoxy group and at the 1-position with a butenyl group, contributing to its unique reactivity and properties. The presence of the double bond in the butenyl chain allows for potential participation in various chemical reactions, such as polymerization or addition reactions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, making it a candidate for applications in organic synthesis and materials science. Additionally, the compound's structure suggests potential uses in the fragrance industry or as a precursor in the synthesis of more complex organic molecules. As with many organic compounds, safety and handling precautions should be observed due to potential reactivity and toxicity.
Formula:C11H14O
InChI:InChI=1/C11H14O/c1-3-4-6-10-7-5-8-11(9-10)12-2/h3,5,7-9H,1,4,6H2,2H3
SMILES:C=CCCc1cccc(c1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
